C31H35N9S — CID 100782417
1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782417) has the molecular formula C31H35N9S and a molecular weight of 565.75 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782417 |
| Molecular Formula | C31H35N9S |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccnc1)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C31H35N9S/c41-31(33-24-25-8-7-13-32-23-25)36-30-34-28(39-18-14-37(15-19-39)26-9-3-1-4-10-26)22-29(35-30)40-20-16-38(17-21-40)27-11-5-2-6-12-27/h1-13,22-23H,14-21,24H2,(H2,33,34,35,36,41) |
| InChIKey | BFYLMMYMDKPWIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|