C22H25N7S — CID 100782486
1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782486) has the molecular formula C22H25N7S and a molecular weight of 419.56 g/mol. Its IUPAC name is 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782486 |
| Molecular Formula | C22H25N7S |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-[4-methyl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1cc(N2CCN(c3ccccc3)CC2)nc(NC(=S)NCc2cccnc2)n1 |
| InChI | InChI=1S/C22H25N7S/c1-17-14-20(29-12-10-28(11-13-29)19-7-3-2-4-8-19)26-21(25-17)27-22(30)24-16-18-6-5-9-23-15-18/h2-9,14-15H,10-13,16H2,1H3,(H2,24,25,26,27,30) |
| InChIKey | HYNVLLHHFMPFOH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|