C16H17ClN2O4S — CID 155747135
4-chloro-2-(furan-2-ylmethylamino)-5-morpholin-4-ylsulfanylbenzoic acid (PubChem CID 155747135) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-5-morpholin-4-ylsulfanylbenzoic acid.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-5-morpholin-4-ylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 155747135 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-5-morpholin-4-ylsulfanylbenzoic acid |
| SMILES | O=C(O)c1cc(SN2CCOCC2)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C16H17ClN2O4S/c17-13-9-14(18-10-11-2-1-5-23-11)12(16(20)21)8-15(13)24-19-3-6-22-7-4-19/h1-2,5,8-9,18H,3-4,6-7,10H2,(H,20,21) |
| InChIKey | ICBXPOJAAYTMET-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|