C19H26N4O3S — CID 68713961
3-amino-4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 68713961) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-amino-4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-amino-4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 68713961 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-amino-4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(N2C[C@H](C)NC[C@H]2C)c(N)c1 |
| InChI | InChI=1S/C19H26N4O3S/c1-13-12-23(14(2)11-21-13)18-9-8-15(10-16(18)20)27(24,25)22-17-6-4-5-7-19(17)26-3/h4-10,13-14,21-22H,11-12,20H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | QMQHTEFAOWLPQN-UONOGXRCSA-N |
| XLogP | 2.26 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|