C19H23Br2N3O3S — CID 69385691
2,4-dibromo-N-[5-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide (PubChem CID 69385691) has the molecular formula C19H23Br2N3O3S and a molecular weight of 533.29 g/mol. Its IUPAC name is 2,4-dibromo-N-[5-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-[5-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69385691 |
| Molecular Formula | C19H23Br2N3O3S |
| Molecular Weight | 533.29 g/mol |
| Exact Mass | 530.98 |
| IUPAC Name | 2,4-dibromo-N-[5-[(2R,5R)-2,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide |
| SMILES | COc1ccc(N2C[C@@H](C)NC[C@H]2C)cc1NS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C19H23Br2N3O3S/c1-12-11-24(13(2)10-22-12)15-5-6-18(27-3)17(9-15)23-28(25,26)19-7-4-14(20)8-16(19)21/h4-9,12-13,22-23H,10-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | UJNVEJVIZJPWRK-CHWSQXEVSA-N |
| XLogP | 4.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|