C23H27N3O3S — CID 69195231
N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide (PubChem CID 69195231) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide.
| Compound Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 69195231 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide |
| SMILES | COc1ccc(N2CC(C)NC(C)C2)cc1NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H27N3O3S/c1-16-14-26(15-17(2)24-16)19-11-12-22(29-3)21(13-19)25-30(27,28)23-10-6-8-18-7-4-5-9-20(18)23/h4-13,16-17,24-25H,14-15H2,1-3H3 |
| InChIKey | KGGJPMYLACRFMM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|