C25H31N3O3S2 — CID 69197763
N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-2-methyl-4-(4-methylthiophen-2-yl)benzenesulfonamide (PubChem CID 69197763) has the molecular formula C25H31N3O3S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-2-methyl-4-(4-methylthiophen-2-yl)benzenesulfonamide.
| Compound Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-2-methyl-4-(4-methylthiophen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 69197763 |
| Molecular Formula | C25H31N3O3S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-2-methyl-4-(4-methylthiophen-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(N2CC(C)NC(C)C2)cc1NS(=O)(=O)c1ccc(-c2cc(C)cs2)cc1C |
| InChI | InChI=1S/C25H31N3O3S2/c1-16-10-24(32-15-16)20-6-9-25(17(2)11-20)33(29,30)27-22-12-21(7-8-23(22)31-5)28-13-18(3)26-19(4)14-28/h6-12,15,18-19,26-27H,13-14H2,1-5H3 |
| InChIKey | YQUFUMUZKKHMOV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|