C24H28FN3O3S2 — CID 69194599
N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-3-fluoro-4-(5-methylthiophen-3-yl)benzenesulfonamide (PubChem CID 69194599) has the molecular formula C24H28FN3O3S2 and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-3-fluoro-4-(5-methylthiophen-3-yl)benzenesulfonamide.
| Compound Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-3-fluoro-4-(5-methylthiophen-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 69194599 |
| Molecular Formula | C24H28FN3O3S2 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-3-fluoro-4-(5-methylthiophen-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(N2CC(C)NC(C)C2)cc1NS(=O)(=O)c1ccc(-c2csc(C)c2)c(F)c1 |
| InChI | InChI=1S/C24H28FN3O3S2/c1-15-12-28(13-16(2)26-15)19-5-8-24(31-4)23(10-19)27-33(29,30)20-6-7-21(22(25)11-20)18-9-17(3)32-14-18/h5-11,14-16,26-27H,12-13H2,1-4H3 |
| InChIKey | MOCBYCDTKLLAID-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|