C25H27ClFN3O3S — CID 69194576
4-(3-chloro-4-fluorophenyl)-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide (PubChem CID 69194576) has the molecular formula C25H27ClFN3O3S and a molecular weight of 504.03 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69194576 |
| Molecular Formula | C25H27ClFN3O3S |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]benzenesulfonamide |
| SMILES | COc1ccc(N2C[C@@H](C)N[C@@H](C)C2)cc1NS(=O)(=O)c1ccc(-c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H27ClFN3O3S/c1-16-14-30(15-17(2)28-16)20-7-11-25(33-3)24(13-20)29-34(31,32)21-8-4-18(5-9-21)19-6-10-23(27)22(26)12-19/h4-13,16-17,28-29H,14-15H2,1-3H3/t16-,17+ |
| InChIKey | BOBQVMNZCPEXTL-CALCHBBNSA-N |
| XLogP | 5.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|