C23H26ClN3O3S — CID 69195552
4-chloro-N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide (PubChem CID 69195552) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 4-chloro-N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide.
| Compound Name | 4-chloro-N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 69195552 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-chloro-N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]naphthalene-1-sulfonamide |
| SMILES | COc1ccc(N2CC(C)NC(C)C2)cc1NS(=O)(=O)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-15-13-27(14-16(2)25-15)17-8-10-22(30-3)21(12-17)26-31(28,29)23-11-9-20(24)18-6-4-5-7-19(18)23/h4-12,15-16,25-26H,13-14H2,1-3H3 |
| InChIKey | JIRIZEHRAWNNOA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|