C23H25N5O5S — CID 11547550
N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-7-(furan-2-yl)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 11547550) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-7-(furan-2-yl)-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-7-(furan-2-yl)-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 11547550 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-7-(furan-2-yl)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | COc1ccc(N2C[C@@H](C)N[C@@H](C)C2)cc1NS(=O)(=O)c1ccc(-c2ccco2)c2nonc12 |
| InChI | InChI=1S/C23H25N5O5S/c1-14-12-28(13-15(2)24-14)16-6-8-20(31-3)18(11-16)27-34(29,30)21-9-7-17(19-5-4-10-32-19)22-23(21)26-33-25-22/h4-11,14-15,24,27H,12-13H2,1-3H3/t14-,15+ |
| InChIKey | AUWYQLHUWSJSDD-GASCZTMLSA-N |
| XLogP | 3.48 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|