C23H28N4O4S — CID 69196553
N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-5-(5-methylfuran-2-yl)pyridine-2-sulfonamide (PubChem CID 69196553) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-5-(5-methylfuran-2-yl)pyridine-2-sulfonamide.
| Compound Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-5-(5-methylfuran-2-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 69196553 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[5-(3,5-dimethylpiperazin-1-yl)-2-methoxyphenyl]-5-(5-methylfuran-2-yl)pyridine-2-sulfonamide |
| SMILES | COc1ccc(N2CC(C)NC(C)C2)cc1NS(=O)(=O)c1ccc(-c2ccc(C)o2)cn1 |
| InChI | InChI=1S/C23H28N4O4S/c1-15-13-27(14-16(2)25-15)19-7-9-22(30-4)20(11-19)26-32(28,29)23-10-6-18(12-24-23)21-8-5-17(3)31-21/h5-12,15-16,25-26H,13-14H2,1-4H3 |
| InChIKey | SFTJLCAWCLWRGW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|