C19H23BrFN3O3S — CID 59007060
4-bromo-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-3-fluorobenzenesulfonamide (PubChem CID 59007060) has the molecular formula C19H23BrFN3O3S and a molecular weight of 472.38 g/mol. Its IUPAC name is 4-bromo-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59007060 |
| Molecular Formula | C19H23BrFN3O3S |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 4-bromo-N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-3-fluorobenzenesulfonamide |
| SMILES | COc1ccc(N2C[C@@H](C)N[C@@H](C)C2)cc1NS(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C19H23BrFN3O3S/c1-12-10-24(11-13(2)22-12)14-4-7-19(27-3)18(8-14)23-28(25,26)15-5-6-16(20)17(21)9-15/h4-9,12-13,22-23H,10-11H2,1-3H3/t12-,13+ |
| InChIKey | NVOPYMDXYJCPET-BETUJISGSA-N |
| XLogP | 3.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|