C20H26IN3O4S — CID 69197436
N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2,4-dimethoxyphenyl]-4-iodobenzenesulfonamide (PubChem CID 69197436) has the molecular formula C20H26IN3O4S and a molecular weight of 531.42 g/mol. Its IUPAC name is N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2,4-dimethoxyphenyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2,4-dimethoxyphenyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 69197436 |
| Molecular Formula | C20H26IN3O4S |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2,4-dimethoxyphenyl]-4-iodobenzenesulfonamide |
| SMILES | COc1cc(OC)c(N2C[C@@H](C)N[C@@H](C)C2)cc1NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H26IN3O4S/c1-13-11-24(12-14(2)22-13)18-9-17(19(27-3)10-20(18)28-4)23-29(25,26)16-7-5-15(21)6-8-16/h5-10,13-14,22-23H,11-12H2,1-4H3/t13-,14+ |
| InChIKey | XAYBUAKEVSSEBO-OKILXGFUSA-N |
| XLogP | 3.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|