C16H19N3O2S — CID 135315096
N-phenyl-4-(2,2,6,6-tetradeuteriopiperazin-1-yl)benzenesulfonamide (PubChem CID 135315096) has the molecular formula C16H19N3O2S and a molecular weight of 321.44 g/mol. Its IUPAC name is N-phenyl-4-(2,2,6,6-tetradeuteriopiperazin-1-yl)benzenesulfonamide.
| Compound Name | N-phenyl-4-(2,2,6,6-tetradeuteriopiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135315096 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-phenyl-4-(2,2,6,6-tetradeuteriopiperazin-1-yl)benzenesulfonamide |
| SMILES | [2H]C1([2H])CNCC([2H])([2H])N1c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c20-22(21,18-14-4-2-1-3-5-14)16-8-6-15(7-9-16)19-12-10-17-11-13-19/h1-9,17-18H,10-13H2/i12D2,13D2 |
| InChIKey | GKBIZJRYEUSKJK-IDPVZSQYSA-N |
| XLogP | 1.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |