C21H19ClN2O2S — CID 112983361
4-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]benzenesulfonamide (PubChem CID 112983361) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is 4-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112983361 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(N2CCc3ccccc3C2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O2S/c22-18-5-11-21(12-6-18)27(25,26)23-19-7-9-20(10-8-19)24-14-13-16-3-1-2-4-17(16)15-24/h1-12,23H,13-15H2 |
| InChIKey | WFCICAAFMPQTKZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|