C16H17Cl2N3O2S — CID 126622029
N-(3,5-dichlorophenyl)-4-piperazin-1-ylbenzenesulfonamide (PubChem CID 126622029) has the molecular formula C16H17Cl2N3O2S and a molecular weight of 386.30 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-piperazin-1-ylbenzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-piperazin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 126622029 |
| Molecular Formula | C16H17Cl2N3O2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-piperazin-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H17Cl2N3O2S/c17-12-9-13(18)11-14(10-12)20-24(22,23)16-3-1-15(2-4-16)21-7-5-19-6-8-21/h1-4,9-11,19-20H,5-8H2 |
| InChIKey | UCDYZDWLWNRAKI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |