C24H22N8O3S — CID 39378671
2-[4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]sulfanylethanol (PubChem CID 39378671) has the molecular formula C24H22N8O3S and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-[4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]sulfanylethanol.
| Compound Name | 2-[4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]sulfanylethanol |
|---|---|
| PubChem CID | 39378671 |
| Molecular Formula | C24H22N8O3S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-[4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]sulfanylethanol |
| SMILES | O=[N+]([O-])c1cc(/C=N/Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)ccc1SCCO |
| InChI | InChI=1S/C24H22N8O3S/c33-13-14-36-21-12-11-17(15-20(21)32(34)35)16-25-31-24-29-22(26-18-7-3-1-4-8-18)28-23(30-24)27-19-9-5-2-6-10-19/h1-12,15-16,33H,13-14H2,(H3,26,27,28,29,30,31)/b25-16+ |
| InChIKey | YUNZMRSRIWUDTA-PCLIKHOPSA-N |
| XLogP | 4.80 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|