C23H19N7O2 — CID 3381171
3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid (PubChem CID 3381171) has the molecular formula C23H19N7O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is 3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 3381171 |
| Molecular Formula | C23H19N7O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C=NNc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H19N7O2/c31-20(32)17-9-7-8-16(14-17)15-24-30-23-28-21(25-18-10-3-1-4-11-18)27-22(29-23)26-19-12-5-2-6-13-19/h1-15H,(H,31,32)(H3,25,26,27,28,29,30) |
| InChIKey | QPCRCAOUYNRAKZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|