C24H23N7O2 — CID 6302561
5-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol (PubChem CID 6302561) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 5-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol.
| Compound Name | 5-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 6302561 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol |
| SMILES | CCOc1ccc(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1O |
| InChI | InChI=1S/C24H23N7O2/c1-2-33-21-14-13-17(15-20(21)32)16-25-31-24-29-22(26-18-9-5-3-6-10-18)28-23(30-24)27-19-11-7-4-8-12-19/h3-16,32H,2H2,1H3,(H3,26,27,28,29,30,31)/b25-16- |
| InChIKey | ATBWANLVTLIXNV-XYGWBWBKSA-N |
| XLogP | 4.91 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|