C20H23N3O7S2 — CID 4845163
N-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetamide (PubChem CID 4845163) has the molecular formula C20H23N3O7S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4845163 |
| Molecular Formula | C20H23N3O7S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetamide |
| SMILES | CC(C)CSc1ccc(S(=O)(=O)NCC(=O)NCc2ccc3c(c2)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N3O7S2/c1-13(2)11-31-19-6-4-15(8-16(19)23(25)26)32(27,28)22-10-20(24)21-9-14-3-5-17-18(7-14)30-12-29-17/h3-8,13,22H,9-12H2,1-2H3,(H,21,24) |
| InChIKey | LWXKBKKDQCIXHE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|