C17H19ClN4O5S — CID 16959340
N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide (PubChem CID 16959340) has the molecular formula C17H19ClN4O5S and a molecular weight of 426.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 16959340 |
| Molecular Formula | C17H19ClN4O5S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide |
| SMILES | CN(C)c1ccc(S(=O)(=O)NCC(=O)NCc2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19ClN4O5S/c1-21(2)15-8-7-14(9-16(15)22(24)25)28(26,27)20-11-17(23)19-10-12-3-5-13(18)6-4-12/h3-9,20H,10-11H2,1-2H3,(H,19,23) |
| InChIKey | XRXLQAKAJNLULM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|