C25H37ClN6O5S — CID 11192363
2-[[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]sulfonylamino]-N,N-bis[3-(dimethylamino)propyl]acetamide (PubChem CID 11192363) has the molecular formula C25H37ClN6O5S and a molecular weight of 569.13 g/mol. Its IUPAC name is 2-[[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]sulfonylamino]-N,N-bis[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-[[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]sulfonylamino]-N,N-bis[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 11192363 |
| Molecular Formula | C25H37ClN6O5S |
| Molecular Weight | 569.13 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 2-[[4-[(4-chlorophenyl)methylamino]-3-nitrophenyl]sulfonylamino]-N,N-bis[3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)CNS(=O)(=O)c1ccc(NCc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H37ClN6O5S/c1-29(2)13-5-15-31(16-6-14-30(3)4)25(33)19-28-38(36,37)22-11-12-23(24(17-22)32(34)35)27-18-20-7-9-21(26)10-8-20/h7-12,17,27-28H,5-6,13-16,18-19H2,1-4H3 |
| InChIKey | ZQTVCTCJPKADRG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|