C20H26N4O7S — CID 3341221
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide (PubChem CID 3341221) has the molecular formula C20H26N4O7S and a molecular weight of 466.52 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 3341221 |
| Molecular Formula | C20H26N4O7S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[4-(dimethylamino)-3-nitrophenyl]sulfonylamino]acetamide |
| SMILES | COc1ccc(CCNC(=O)CNS(=O)(=O)c2ccc(N(C)C)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C20H26N4O7S/c1-23(2)16-7-6-15(12-17(16)24(26)27)32(28,29)22-13-20(25)21-10-9-14-5-8-18(30-3)19(11-14)31-4/h5-8,11-12,22H,9-10,13H2,1-4H3,(H,21,25) |
| InChIKey | MIWGZCLDMRRZLA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|