C18H19ClN2O6S — CID 4256696
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 4256696) has the molecular formula C18H19ClN2O6S and a molecular weight of 426.88 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 4256696 |
| Molecular Formula | C18H19ClN2O6S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19ClN2O6S/c1-12-3-6-14(7-4-12)28(24,25)20-10-18(23)27-11-17(22)21-15-9-13(19)5-8-16(15)26-2/h3-9,20H,10-11H2,1-2H3,(H,21,22) |
| InChIKey | FTWLLGJUYFFXPT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |