C18H18ClNO6S — CID 7978211
[2-(4-methoxyphenyl)-2-oxoethyl] 3-[(2-chlorophenyl)sulfonylamino]propanoate (PubChem CID 7978211) has the molecular formula C18H18ClNO6S and a molecular weight of 411.86 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 3-[(2-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-[(2-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7978211 |
| Molecular Formula | C18H18ClNO6S |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-[(2-chlorophenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCNS(=O)(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO6S/c1-25-14-8-6-13(7-9-14)16(21)12-26-18(22)10-11-20-27(23,24)17-5-3-2-4-15(17)19/h2-9,20H,10-12H2,1H3 |
| InChIKey | IGPLOHAUQRKMOV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |