C32H47BrO4Si — CID 10698879
1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-[4-(4-bromophenyl)phenyl]ethyl]-2-butylpentanedioate (PubChem CID 10698879) has the molecular formula C32H47BrO4Si and a molecular weight of 603.71 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-[4-(4-bromophenyl)phenyl]ethyl]-2-butylpentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-[4-(4-bromophenyl)phenyl]ethyl]-2-butylpentanedioate |
|---|---|
| PubChem CID | 10698879 |
| Molecular Formula | C32H47BrO4Si |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-[4-(4-bromophenyl)phenyl]ethyl]-2-butylpentanedioate |
| SMILES | CCCCC(C[C@@H](CCc1ccc(-c2ccc(Br)cc2)cc1)C(=O)OCC[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H47BrO4Si/c1-8-9-10-27(31(35)37-32(2,3)4)23-28(30(34)36-21-22-38(5,6)7)16-13-24-11-14-25(15-12-24)26-17-19-29(33)20-18-26/h11-12,14-15,17-20,27-28H,8-10,13,16,21-23H2,1-7H3/t27?,28-/m1/s1 |
| InChIKey | AWWGPJKVNLMIOO-PLYLYKGUSA-N |
| XLogP | 9.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|