C39H57NO6Si — CID 22864805
1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2R,4R)-2-butyl-4-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]phenyl]ethyl]pentanedioate (PubChem CID 22864805) has the molecular formula C39H57NO6Si and a molecular weight of 663.97 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2R,4R)-2-butyl-4-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]phenyl]ethyl]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2R,4R)-2-butyl-4-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]phenyl]ethyl]pentanedioate |
|---|---|
| PubChem CID | 22864805 |
| Molecular Formula | C39H57NO6Si |
| Molecular Weight | 663.97 g/mol |
| Exact Mass | 663.40 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2R,4R)-2-butyl-4-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]phenyl]ethyl]pentanedioate |
| SMILES | CCCC[C@H](C[C@@H](CCc1ccc(-c2cc3ccccc3n2C(=O)OC(C)(C)C)cc1)C(=O)OCC[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H57NO6Si/c1-11-12-15-31(36(42)45-38(2,3)4)26-32(35(41)44-24-25-47(8,9)10)23-20-28-18-21-29(22-19-28)34-27-30-16-13-14-17-33(30)40(34)37(43)46-39(5,6)7/h13-14,16-19,21-22,27,31-32H,11-12,15,20,23-26H2,1-10H3/t31-,32-/m1/s1 |
| InChIKey | FXHYJGXYUAZXIH-ROJLCIKYSA-N |
| XLogP | 10.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.97 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|