C34H51NO5Si — CID 10579155
1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-2-butyl-4-[2-[4-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]pentanedioate (PubChem CID 10579155) has the molecular formula C34H51NO5Si and a molecular weight of 581.87 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-2-butyl-4-[2-[4-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-2-butyl-4-[2-[4-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]pentanedioate |
|---|---|
| PubChem CID | 10579155 |
| Molecular Formula | C34H51NO5Si |
| Molecular Weight | 581.87 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-2-butyl-4-[2-[4-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]pentanedioate |
| SMILES | CCCC[C@@H](C[C@@H](CCc1ccc(-c2ccc(C(=O)NC)cc2)cc1)C(=O)OCC[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H51NO5Si/c1-9-10-11-29(33(38)40-34(2,3)4)24-30(32(37)39-22-23-41(6,7)8)17-14-25-12-15-26(16-13-25)27-18-20-28(21-19-27)31(36)35-5/h12-13,15-16,18-21,29-30H,9-11,14,17,22-24H2,1-8H3,(H,35,36)/t29-,30+/m0/s1 |
| InChIKey | KJLLURJLLDRCBB-XZWHSSHBSA-N |
| XLogP | 7.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.87 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|