About 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate
1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate (PubChem CID 10554425) has the molecular formula C33H50O4Si
and a molecular weight of 538.85 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate |
| PubChem CID | 10554425 |
| Molecular Formula | C33H50O4Si |
| Molecular Weight | 538.85 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate |
| SMILES | CCCCC(C[C@@H](CCc1ccc(Cc2ccccc2)cc1)C(=O)OCC[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H50O4Si/c1-8-9-15-29(32(35)37-33(2,3)4)25-30(31(34)36-22-23-38(5,6)7)21-20-26-16-18-28(19-17-26)24-27-13-11-10-12-14-27/h10-14,16-19,29-30H,8-9,15,20-25H2,1-7H3/t29?,30-/m1/s1 |
| InChIKey | ZUJKEDMCZGSCDB-BDCODIICSA-N |
| XLogP | 8.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.85 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate?
The IUPAC name of 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate (CID 10554425) is 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate is CCCCC(C[C@@H](CCc1ccc(Cc2ccccc2)cc1)C(=O)OCC[Si](C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate?
The InChIKey is ZUJKEDMCZGSCDB-BDCODIICSA-N. The full InChI is InChI=1S/C33H50O4Si/c1-8-9-15-29(32(35)37-33(2,3)4)25-30(31(34)36-22-23-38(5,6)7)21-20-26-16-18-28(19-17-26)24-27-13-11-10-12-14-27/h10-14,16-19,29-30H,8-9,15,20-25H2,1-7H3/t29?,30-/m1/s1.
What are the key properties of 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate?
1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate has a molecular weight of 538.85 g/mol, XLogP of 8.25, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-(2-trimethylsilylethyl) (2S,4R)-4-[2-(4-benzylphenyl)ethyl]-2-butylpentanedioate is sourced from PubChem (CID 10554425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).