C30H41BrN4O2 — CID 118499999
tert-butyl 2-[(1S)-2-(4-bromophenyl)-1-[2-[(4-pentylphenyl)methyl]tetrazol-5-yl]ethyl]pentanoate (PubChem CID 118499999) has the molecular formula C30H41BrN4O2 and a molecular weight of 569.59 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-2-(4-bromophenyl)-1-[2-[(4-pentylphenyl)methyl]tetrazol-5-yl]ethyl]pentanoate.
| Compound Name | tert-butyl 2-[(1S)-2-(4-bromophenyl)-1-[2-[(4-pentylphenyl)methyl]tetrazol-5-yl]ethyl]pentanoate |
|---|---|
| PubChem CID | 118499999 |
| Molecular Formula | C30H41BrN4O2 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | tert-butyl 2-[(1S)-2-(4-bromophenyl)-1-[2-[(4-pentylphenyl)methyl]tetrazol-5-yl]ethyl]pentanoate |
| SMILES | CCCCCc1ccc(Cn2nnc([C@@H](Cc3ccc(Br)cc3)C(CCC)C(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C30H41BrN4O2/c1-6-8-9-11-22-12-14-24(15-13-22)21-35-33-28(32-34-35)27(20-23-16-18-25(31)19-17-23)26(10-7-2)29(36)37-30(3,4)5/h12-19,26-27H,6-11,20-21H2,1-5H3/t26?,27-/m0/s1 |
| InChIKey | UGRUZZAEEGXYID-GEVKEYJPSA-N |
| XLogP | 7.30 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|