C14H27N3OSi — CID 123770729
5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]pyridazin-3-amine (PubChem CID 123770729) has the molecular formula C14H27N3OSi and a molecular weight of 281.48 g/mol. Its IUPAC name is 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]pyridazin-3-amine.
| Compound Name | 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 123770729 |
| Molecular Formula | C14H27N3OSi |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]pyridazin-3-amine |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)c1cnnc(N)c1 |
| InChI | InChI=1S/C14H27N3OSi/c1-13(2,3)19(6,7)18-10-14(4,5)11-8-12(15)17-16-9-11/h8-9H,10H2,1-7H3,(H2,15,17) |
| InChIKey | BMJUOONJBYKQLB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|