C18H29F3O2Si — CID 169256906
4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-5-(trifluoromethyl)phenol (PubChem CID 169256906) has the molecular formula C18H29F3O2Si and a molecular weight of 362.51 g/mol. Its IUPAC name is 4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-5-(trifluoromethyl)phenol.
| Compound Name | 4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 169256906 |
| Molecular Formula | C18H29F3O2Si |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methyl-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(C(C)(C)CO[Si](C)(C)C(C)(C)C)c(C(F)(F)F)cc1O |
| InChI | InChI=1S/C18H29F3O2Si/c1-12-9-13(14(10-15(12)22)18(19,20)21)17(5,6)11-23-24(7,8)16(2,3)4/h9-10,22H,11H2,1-8H3 |
| InChIKey | KWXZSZVNBASJBQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|