C13H25N3OSi — CID 171478642
6-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyridazin-4-amine (PubChem CID 171478642) has the molecular formula C13H25N3OSi and a molecular weight of 267.45 g/mol. Its IUPAC name is 6-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyridazin-4-amine.
| Compound Name | 6-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyridazin-4-amine |
|---|---|
| PubChem CID | 171478642 |
| Molecular Formula | C13H25N3OSi |
| Molecular Weight | 267.45 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 6-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyridazin-4-amine |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)C)c1cc(N)cnn1 |
| InChI | InChI=1S/C13H25N3OSi/c1-12(2,3)18(6,7)17-13(4,5)11-8-10(14)9-15-16-11/h8-9H,1-7H3,(H2,14,16) |
| InChIKey | ZMXGFTGPXCIKDB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|