C15H31N3O2Si2 — CID 91740907
tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,2,4-triazin-5-yl]oxy]-dimethylsilane (PubChem CID 91740907) has the molecular formula C15H31N3O2Si2 and a molecular weight of 341.60 g/mol. Its IUPAC name is tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,2,4-triazin-5-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,2,4-triazin-5-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 91740907 |
| Molecular Formula | C15H31N3O2Si2 |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-1,2,4-triazin-5-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cnnc(O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H31N3O2Si2/c1-14(2,3)21(7,8)19-12-11-16-18-13(17-12)20-22(9,10)15(4,5)6/h11H,1-10H3 |
| InChIKey | JLFOXRXXJLMZMS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|