C9H19N5OSi — CID 91728482
6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine (PubChem CID 91728482) has the molecular formula C9H19N5OSi and a molecular weight of 241.37 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91728482 |
| Molecular Formula | C9H19N5OSi |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(C)[Si](C)(C)Oc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H19N5OSi/c1-9(2,3)16(4,5)15-8-13-6(10)12-7(11)14-8/h1-5H3,(H4,10,11,12,13,14) |
| InChIKey | DRSQWGPZGXUAOG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|