C4H5F2N5O — CID 133061552
6-(difluoromethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 133061552) has the molecular formula C4H5F2N5O and a molecular weight of 177.11 g/mol. Its IUPAC name is 6-(difluoromethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(difluoromethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 133061552 |
| Molecular Formula | C4H5F2N5O |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 6-(difluoromethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(OC(F)F)n1 |
| InChI | InChI=1S/C4H5F2N5O/c5-1(6)12-4-10-2(7)9-3(8)11-4/h1H,(H4,7,8,9,10,11) |
| InChIKey | XUKBDEUFUURNPZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |