C7H16N6O3 — CID 89428921
1,1-dimethoxyethanol;1,3,5-triazine-2,4,6-triamine (PubChem CID 89428921) has the molecular formula C7H16N6O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1,1-dimethoxyethanol;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1,1-dimethoxyethanol;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 89428921 |
| Molecular Formula | C7H16N6O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1,1-dimethoxyethanol;1,3,5-triazine-2,4,6-triamine |
| SMILES | COC(C)(O)OC.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H10O3.C3H6N6/c1-4(5,6-2)7-3;4-1-7-2(5)9-3(6)8-1/h5H,1-3H3;(H6,4,5,6,7,8,9) |
| InChIKey | JZLGPFRTHDUHDG-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|