C9H17N5O4 — CID 122446894
6-(1,1,2,2-tetramethoxyethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 122446894) has the molecular formula C9H17N5O4 and a molecular weight of 259.27 g/mol. Its IUPAC name is 6-(1,1,2,2-tetramethoxyethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,1,2,2-tetramethoxyethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 122446894 |
| Molecular Formula | C9H17N5O4 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-(1,1,2,2-tetramethoxyethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COC(OC)C(OC)(OC)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H17N5O4/c1-15-6(16-2)9(17-3,18-4)5-12-7(10)14-8(11)13-5/h6H,1-4H3,(H4,10,11,12,13,14) |
| InChIKey | TVSHCWYZPLTSRR-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|