C19H31N5 — CID 175268076
6-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine;1,2-xylene (PubChem CID 175268076) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is 6-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine;1,2-xylene.
| Compound Name | 6-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine;1,2-xylene |
|---|---|
| PubChem CID | 175268076 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 6-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine;1,2-xylene |
| SMILES | CC(C)(C)CC(C)(C)c1nc(N)nc(N)n1.Cc1ccccc1C |
| InChI | InChI=1S/C11H21N5.C8H10/c1-10(2,3)6-11(4,5)7-14-8(12)16-9(13)15-7;1-7-5-3-4-6-8(7)2/h6H2,1-5H3,(H4,12,13,14,15,16);3-6H,1-2H3 |
| InChIKey | REMLUHAIMLYGAY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |