About ethanamine;1,2-xylene
ethanamine;1,2-xylene (PubChem CID 160781195) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is ethanamine;1,2-xylene.
Molecular Properties
| Compound Name | ethanamine;1,2-xylene |
| PubChem CID | 160781195 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | ethanamine;1,2-xylene |
| SMILES | CCN.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C2H7N/c1-7-5-3-4-6-8(7)2;1-2-3/h3-6H,1-2H3;2-3H2,1H3 |
| InChIKey | SAPDNENPWVCNDP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanamine;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;1,2-xylene?
The IUPAC name of ethanamine;1,2-xylene (CID 160781195) is ethanamine;1,2-xylene.
What is the SMILES notation for ethanamine;1,2-xylene?
The canonical SMILES for ethanamine;1,2-xylene is CCN.Cc1ccccc1C.
What is the InChIKey of ethanamine;1,2-xylene?
The InChIKey is SAPDNENPWVCNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C2H7N/c1-7-5-3-4-6-8(7)2;1-2-3/h3-6H,1-2H3;2-3H2,1H3.
What are the key properties of ethanamine;1,2-xylene?
ethanamine;1,2-xylene has a molecular weight of 151.25 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;1,2-xylene is sourced from PubChem (CID 160781195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).