C9H17NO2Si — CID 158223424
tert-butyl-dimethyl-(1,3-oxazol-2-yloxy)silane (PubChem CID 158223424) has the molecular formula C9H17NO2Si and a molecular weight of 199.33 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1,3-oxazol-2-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(1,3-oxazol-2-yloxy)silane |
|---|---|
| PubChem CID | 158223424 |
| Molecular Formula | C9H17NO2Si |
| Molecular Weight | 199.33 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | tert-butyl-dimethyl-(1,3-oxazol-2-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ncco1 |
| InChI | InChI=1S/C9H17NO2Si/c1-9(2,3)13(4,5)12-8-10-6-7-11-8/h6-7H,1-5H3 |
| InChIKey | GDNBQSMKKDZXIA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|