C8H13NO2 — CID 59855688
2-(3-methylbutoxy)-1,3-oxazole (PubChem CID 59855688) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-(3-methylbutoxy)-1,3-oxazole.
| Compound Name | 2-(3-methylbutoxy)-1,3-oxazole |
|---|---|
| PubChem CID | 59855688 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-(3-methylbutoxy)-1,3-oxazole |
| SMILES | CC(C)CCOc1ncco1 |
| InChI | InChI=1S/C8H13NO2/c1-7(2)3-5-10-8-9-4-6-11-8/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | NJWSPKSGXHCVDG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |