C15H29NOSn — CID 142789943
tris(2-methylpropyl)-(1,3-oxazol-2-yl)stannane (PubChem CID 142789943) has the molecular formula C15H29NOSn and a molecular weight of 358.11 g/mol. Its IUPAC name is tris(2-methylpropyl)-(1,3-oxazol-2-yl)stannane.
| Compound Name | tris(2-methylpropyl)-(1,3-oxazol-2-yl)stannane |
|---|---|
| PubChem CID | 142789943 |
| Molecular Formula | C15H29NOSn |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | tris(2-methylpropyl)-(1,3-oxazol-2-yl)stannane |
| SMILES | CC(C)C[Sn](CC(C)C)(CC(C)C)c1ncco1 |
| InChI | InChI=1S/3C4H9.C3H2NO.Sn/c3*1-4(2)3;1-2-5-3-4-1;/h3*4H,1H2,2-3H3;1-2H; |
| InChIKey | QQOOFWQKOJONHK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |