About 2-[(1R)-1-iodoethyl]-1,3-oxazole
2-[(1R)-1-iodoethyl]-1,3-oxazole (PubChem CID 149131745) has the molecular formula C5H6INO
and a molecular weight of 223.01 g/mol. Its IUPAC name is 2-[(1R)-1-iodoethyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(1R)-1-iodoethyl]-1,3-oxazole |
| PubChem CID | 149131745 |
| Molecular Formula | C5H6INO |
| Molecular Weight | 223.01 g/mol |
| Exact Mass | 222.95 |
| IUPAC Name | 2-[(1R)-1-iodoethyl]-1,3-oxazole |
| SMILES | C[C@@H](I)c1ncco1 |
| InChI | InChI=1S/C5H6INO/c1-4(6)5-7-2-3-8-5/h2-4H,1H3/t4-/m1/s1 |
| InChIKey | RCQAQWIXLZKBLS-SCSAIBSYSA-N |
| XLogP | 2.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.01 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-1-iodoethyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-iodoethyl]-1,3-oxazole?
The IUPAC name of 2-[(1R)-1-iodoethyl]-1,3-oxazole (CID 149131745) is 2-[(1R)-1-iodoethyl]-1,3-oxazole.
What is the SMILES notation for 2-[(1R)-1-iodoethyl]-1,3-oxazole?
The canonical SMILES for 2-[(1R)-1-iodoethyl]-1,3-oxazole is C[C@@H](I)c1ncco1.
What is the InChIKey of 2-[(1R)-1-iodoethyl]-1,3-oxazole?
The InChIKey is RCQAQWIXLZKBLS-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H6INO/c1-4(6)5-7-2-3-8-5/h2-4H,1H3/t4-/m1/s1.
What are the key properties of 2-[(1R)-1-iodoethyl]-1,3-oxazole?
2-[(1R)-1-iodoethyl]-1,3-oxazole has a molecular weight of 223.01 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-iodoethyl]-1,3-oxazole is sourced from PubChem (CID 149131745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).