C6H6N2O — CID 119087354
2-(1,3-oxazol-2-yl)propanenitrile (PubChem CID 119087354) has the molecular formula C6H6N2O and a molecular weight of 122.13 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-yl)propanenitrile.
| Compound Name | 2-(1,3-oxazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 119087354 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 2-(1,3-oxazol-2-yl)propanenitrile |
| SMILES | CC(C#N)c1ncco1 |
| InChI | InChI=1S/C6H6N2O/c1-5(4-7)6-8-2-3-9-6/h2-3,5H,1H3 |
| InChIKey | WVUAOAIHXFZJLE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |