C14H25ClN2OSi — CID 174170052
6-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-chloropyridin-3-amine (PubChem CID 174170052) has the molecular formula C14H25ClN2OSi and a molecular weight of 300.91 g/mol. Its IUPAC name is 6-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-chloropyridin-3-amine.
| Compound Name | 6-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-chloropyridin-3-amine |
|---|---|
| PubChem CID | 174170052 |
| Molecular Formula | C14H25ClN2OSi |
| Molecular Weight | 300.91 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-chloropyridin-3-amine |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)c1ncc(N)cc1Cl |
| InChI | InChI=1S/C14H25ClN2OSi/c1-10(9-18-19(5,6)14(2,3)4)13-12(15)7-11(16)8-17-13/h7-8,10H,9,16H2,1-6H3 |
| InChIKey | HCNUGBTVTBRPIK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|