C14H25ClN2O2Si — CID 156802926
6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-chloropyridin-3-amine (PubChem CID 156802926) has the molecular formula C14H25ClN2O2Si and a molecular weight of 316.91 g/mol. Its IUPAC name is 6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-chloropyridin-3-amine.
| Compound Name | 6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-chloropyridin-3-amine |
|---|---|
| PubChem CID | 156802926 |
| Molecular Formula | C14H25ClN2O2Si |
| Molecular Weight | 316.91 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-chloropyridin-3-amine |
| SMILES | C[C@H](COc1ncc(N)cc1Cl)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H25ClN2O2Si/c1-10(19-20(5,6)14(2,3)4)9-18-13-12(15)7-11(16)8-17-13/h7-8,10H,9,16H2,1-6H3/t10-/m1/s1 |
| InChIKey | XILNJHZQRPLYNH-SNVBAGLBSA-N |
| XLogP | 4.11 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|