C13H23ClN2OSi — CID 171062417
tert-butyl-[(2R)-1-(2-chloropyrimidin-4-yl)propan-2-yl]oxy-dimethylsilane (PubChem CID 171062417) has the molecular formula C13H23ClN2OSi and a molecular weight of 286.88 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-(2-chloropyrimidin-4-yl)propan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-1-(2-chloropyrimidin-4-yl)propan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 171062417 |
| Molecular Formula | C13H23ClN2OSi |
| Molecular Weight | 286.88 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | tert-butyl-[(2R)-1-(2-chloropyrimidin-4-yl)propan-2-yl]oxy-dimethylsilane |
| SMILES | C[C@H](Cc1ccnc(Cl)n1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H23ClN2OSi/c1-10(17-18(5,6)13(2,3)4)9-11-7-8-15-12(14)16-11/h7-8,10H,9H2,1-6H3/t10-/m1/s1 |
| InChIKey | INQVBIPSDBBCLH-SNVBAGLBSA-N |
| XLogP | 4.08 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|