C22H31ClN2O4Si — CID 156720760
ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[2-[(2-chloropyrimidin-4-yl)methoxy]phenyl]propanoate (PubChem CID 156720760) has the molecular formula C22H31ClN2O4Si and a molecular weight of 451.04 g/mol. Its IUPAC name is ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[2-[(2-chloropyrimidin-4-yl)methoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[2-[(2-chloropyrimidin-4-yl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 156720760 |
| Molecular Formula | C22H31ClN2O4Si |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[2-[(2-chloropyrimidin-4-yl)methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1OCc1ccnc(Cl)n1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H31ClN2O4Si/c1-7-27-20(26)19(29-30(5,6)22(2,3)4)14-16-10-8-9-11-18(16)28-15-17-12-13-24-21(23)25-17/h8-13,19H,7,14-15H2,1-6H3/t19-/m0/s1 |
| InChIKey | ULIHPBCIBBLVOB-IBGZPJMESA-N |
| XLogP | 5.20 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|